C48H48N4O2 — CID 96582243
2-(tritylamino)-N-[(1S,2S)-2-[[2-(tritylamino)acetyl]amino]cyclohexyl]acetamide (PubChem CID 96582243) has the molecular formula C48H48N4O2 and a molecular weight of 712.94 g/mol. Its IUPAC name is 2-(tritylamino)-N-[(1S,2S)-2-[[2-(tritylamino)acetyl]amino]cyclohexyl]acetamide.
| Compound Name | 2-(tritylamino)-N-[(1S,2S)-2-[[2-(tritylamino)acetyl]amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 96582243 |
| Molecular Formula | C48H48N4O2 |
| Molecular Weight | 712.94 g/mol |
| Exact Mass | 712.38 |
| IUPAC Name | 2-(tritylamino)-N-[(1S,2S)-2-[[2-(tritylamino)acetyl]amino]cyclohexyl]acetamide |
| SMILES | O=C(CNC(c1ccccc1)(c1ccccc1)c1ccccc1)N[C@H]1CCCC[C@@H]1NC(=O)CNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H48N4O2/c53-45(35-49-47(37-21-7-1-8-22-37,38-23-9-2-10-24-38)39-25-11-3-12-26-39)51-43-33-19-20-34-44(43)52-46(54)36-50-48(40-27-13-4-14-28-40,41-29-15-5-16-30-41)42-31-17-6-18-32-42/h1-18,21-32,43-44,49-50H,19-20,33-36H2,(H,51,53)(H,52,54)/t43-,44-/m0/s1 |
| InChIKey | ZZKCTZWBXPGUEP-CXNSMIOJSA-N |
| XLogP | 7.69 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.94 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|