C23H26N2O2 — CID 43835039
acetic acid;N'-tritylethane-1,2-diamine (PubChem CID 43835039) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is acetic acid;N'-tritylethane-1,2-diamine.
| Compound Name | acetic acid;N'-tritylethane-1,2-diamine |
|---|---|
| PubChem CID | 43835039 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | acetic acid;N'-tritylethane-1,2-diamine |
| SMILES | CC(=O)O.NCCNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H22N2.C2H4O2/c22-16-17-23-21(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;1-2(3)4/h1-15,23H,16-17,22H2;1H3,(H,3,4) |
| InChIKey | DUNZNRMJKLYTSM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|