C25H29N3O2 — CID 19438547
N-(2-aminoethyl)-4-hydroxy-2-(tritylamino)butanamide (PubChem CID 19438547) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-hydroxy-2-(tritylamino)butanamide.
| Compound Name | N-(2-aminoethyl)-4-hydroxy-2-(tritylamino)butanamide |
|---|---|
| PubChem CID | 19438547 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-(2-aminoethyl)-4-hydroxy-2-(tritylamino)butanamide |
| SMILES | NCCNC(=O)C(CCO)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29N3O2/c26-17-18-27-24(30)23(16-19-29)28-25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,23,28-29H,16-19,26H2,(H,27,30) |
| InChIKey | ODYLNTAUBXARMJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|