C27H34N2O2S — CID 90477349
N-ethylethanamine;(2R)-3-methylsulfanyl-2-(tritylamino)propanoic acid (PubChem CID 90477349) has the molecular formula C27H34N2O2S and a molecular weight of 450.65 g/mol. Its IUPAC name is N-ethylethanamine;(2R)-3-methylsulfanyl-2-(tritylamino)propanoic acid.
| Compound Name | N-ethylethanamine;(2R)-3-methylsulfanyl-2-(tritylamino)propanoic acid |
|---|---|
| PubChem CID | 90477349 |
| Molecular Formula | C27H34N2O2S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-ethylethanamine;(2R)-3-methylsulfanyl-2-(tritylamino)propanoic acid |
| SMILES | CCNCC.CSC[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H23NO2S.C4H11N/c1-27-17-21(22(25)26)24-23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;1-3-5-4-2/h2-16,21,24H,17H2,1H3,(H,25,26);5H,3-4H2,1-2H3/t21-;/m0./s1 |
| InChIKey | QOGJMCVCQTUBSF-BOXHHOBZSA-N |
| XLogP | 5.00 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|