C28H36N2O2S — CID 72698592
diethylazanium;(2S)-4-methylsulfanyl-2-(tritylamino)butanoate (PubChem CID 72698592) has the molecular formula C28H36N2O2S and a molecular weight of 464.68 g/mol. Its IUPAC name is diethylazanium;(2S)-4-methylsulfanyl-2-(tritylamino)butanoate.
| Compound Name | diethylazanium;(2S)-4-methylsulfanyl-2-(tritylamino)butanoate |
|---|---|
| PubChem CID | 72698592 |
| Molecular Formula | C28H36N2O2S |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | diethylazanium;(2S)-4-methylsulfanyl-2-(tritylamino)butanoate |
| SMILES | CC[NH2+]CC.CSCC[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C24H25NO2S.C4H11N/c1-28-18-17-22(23(26)27)25-24(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21;1-3-5-4-2/h2-16,22,25H,17-18H2,1H3,(H,26,27);5H,3-4H2,1-2H3/t22-;/m0./s1 |
| InChIKey | NKPFPDOUAIDXSZ-FTBISJDPSA-N |
| XLogP | 3.03 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|