C32H44N2O3 — CID 131726683
2-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexanoate;triethylazanium (PubChem CID 131726683) has the molecular formula C32H44N2O3 and a molecular weight of 504.72 g/mol. Its IUPAC name is 2-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexanoate;triethylazanium.
| Compound Name | 2-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexanoate;triethylazanium |
|---|---|
| PubChem CID | 131726683 |
| Molecular Formula | C32H44N2O3 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | 2-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexanoate;triethylazanium |
| SMILES | CCCCC(NC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1)C(=O)[O-].CC[NH+](CC)CC |
| InChI | InChI=1S/C26H29NO3.C6H15N/c1-3-4-15-24(25(28)29)27-26(20-11-7-5-8-12-20,21-13-9-6-10-14-21)22-16-18-23(30-2)19-17-22;1-4-7(5-2)6-3/h5-14,16-19,24,27H,3-4,15H2,1-2H3,(H,28,29);4-6H2,1-3H3 |
| InChIKey | FEXRSWARNLNYOB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 65.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|