C26H28N2O3S — CID 154136658
2-[[(2S)-4-methylsulfanyl-2-(tritylamino)butanoyl]amino]acetic acid (PubChem CID 154136658) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is 2-[[(2S)-4-methylsulfanyl-2-(tritylamino)butanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-4-methylsulfanyl-2-(tritylamino)butanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 154136658 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-[[(2S)-4-methylsulfanyl-2-(tritylamino)butanoyl]amino]acetic acid |
| SMILES | CSCC[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C26H28N2O3S/c1-32-18-17-23(25(31)27-19-24(29)30)28-26(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,23,28H,17-19H2,1H3,(H,27,31)(H,29,30)/t23-/m0/s1 |
| InChIKey | CEGPFQKGLAYRBJ-QHCPKHFHSA-N |
| XLogP | 3.89 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|