C15H17N3O4S — CID 4835959
2-[[4-methylsulfanyl-2-(4-oxoquinazolin-3-yl)butanoyl]amino]acetic acid (PubChem CID 4835959) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is 2-[[4-methylsulfanyl-2-(4-oxoquinazolin-3-yl)butanoyl]amino]acetic acid.
| Compound Name | 2-[[4-methylsulfanyl-2-(4-oxoquinazolin-3-yl)butanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 4835959 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-[[4-methylsulfanyl-2-(4-oxoquinazolin-3-yl)butanoyl]amino]acetic acid |
| SMILES | CSCCC(C(=O)NCC(=O)O)n1cnc2ccccc2c1=O |
| InChI | InChI=1S/C15H17N3O4S/c1-23-7-6-12(14(21)16-8-13(19)20)18-9-17-11-5-3-2-4-10(11)15(18)22/h2-5,9,12H,6-8H2,1H3,(H,16,21)(H,19,20) |
| InChIKey | ZKBZOFADGLHAJX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |