C20H19N3O4 — CID 4836394
4-[[2-(4-oxoquinazolin-3-yl)-2-phenylacetyl]amino]butanoic acid (PubChem CID 4836394) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 4-[[2-(4-oxoquinazolin-3-yl)-2-phenylacetyl]amino]butanoic acid.
| Compound Name | 4-[[2-(4-oxoquinazolin-3-yl)-2-phenylacetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 4836394 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-[[2-(4-oxoquinazolin-3-yl)-2-phenylacetyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)C(c1ccccc1)n1cnc2ccccc2c1=O |
| InChI | InChI=1S/C20H19N3O4/c24-17(25)11-6-12-21-19(26)18(14-7-2-1-3-8-14)23-13-22-16-10-5-4-9-15(16)20(23)27/h1-5,7-10,13,18H,6,11-12H2,(H,21,26)(H,24,25) |
| InChIKey | RQVFBROCUYLCNM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|