C23H26N4O2S — CID 167643351
ethane;2-(4-oxoquinazolin-3-yl)-2-phenyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 167643351) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is ethane;2-(4-oxoquinazolin-3-yl)-2-phenyl-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | ethane;2-(4-oxoquinazolin-3-yl)-2-phenyl-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 167643351 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | ethane;2-(4-oxoquinazolin-3-yl)-2-phenyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CC.CC.O=C(Nc1nccs1)C(c1ccccc1)n1cnc2ccccc2c1=O |
| InChI | InChI=1S/C19H14N4O2S.2C2H6/c24-17(22-19-20-10-11-26-19)16(13-6-2-1-3-7-13)23-12-21-15-9-5-4-8-14(15)18(23)25;2*1-2/h1-12,16H,(H,20,22,24);2*1-2H3 |
| InChIKey | PMIIXJCRWJVDNC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |