C18H14N4O2S — CID 175779663
(2R)-2-(6-hydroxyindazol-2-yl)-2-phenyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 175779663) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is (2R)-2-(6-hydroxyindazol-2-yl)-2-phenyl-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | (2R)-2-(6-hydroxyindazol-2-yl)-2-phenyl-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 175779663 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (2R)-2-(6-hydroxyindazol-2-yl)-2-phenyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Nc1nccs1)[C@@H](c1ccccc1)n1cc2ccc(O)cc2n1 |
| InChI | InChI=1S/C18H14N4O2S/c23-14-7-6-13-11-22(21-15(13)10-14)16(12-4-2-1-3-5-12)17(24)20-18-19-8-9-25-18/h1-11,16,23H,(H,19,20,24)/t16-/m1/s1 |
| InChIKey | AOCOEKDWADDUPL-MRXNPFEDSA-N |
| XLogP | 3.43 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |