C17H22N4O4 — CID 4970961
4-[2-(4-oxo-1,2,3-benzotriazin-3-yl)hexanoylamino]butanoic acid (PubChem CID 4970961) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-[2-(4-oxo-1,2,3-benzotriazin-3-yl)hexanoylamino]butanoic acid.
| Compound Name | 4-[2-(4-oxo-1,2,3-benzotriazin-3-yl)hexanoylamino]butanoic acid |
|---|---|
| PubChem CID | 4970961 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4-[2-(4-oxo-1,2,3-benzotriazin-3-yl)hexanoylamino]butanoic acid |
| SMILES | CCCCC(C(=O)NCCCC(=O)O)n1nnc2ccccc2c1=O |
| InChI | InChI=1S/C17H22N4O4/c1-2-3-9-14(16(24)18-11-6-10-15(22)23)21-17(25)12-7-4-5-8-13(12)19-20-21/h4-5,7-8,14H,2-3,6,9-11H2,1H3,(H,18,24)(H,22,23) |
| InChIKey | JCBQXUOHLHYVKD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|