C17H15BrN4O2 — CID 7618525
(2S)-N-(2-bromophenyl)-2-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide (PubChem CID 7618525) has the molecular formula C17H15BrN4O2 and a molecular weight of 387.24 g/mol. Its IUPAC name is (2S)-N-(2-bromophenyl)-2-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide.
| Compound Name | (2S)-N-(2-bromophenyl)-2-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide |
|---|---|
| PubChem CID | 7618525 |
| Molecular Formula | C17H15BrN4O2 |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | (2S)-N-(2-bromophenyl)-2-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide |
| SMILES | CC[C@@H](C(=O)Nc1ccccc1Br)n1nnc2ccccc2c1=O |
| InChI | InChI=1S/C17H15BrN4O2/c1-2-15(16(23)19-14-10-6-4-8-12(14)18)22-17(24)11-7-3-5-9-13(11)20-21-22/h3-10,15H,2H2,1H3,(H,19,23)/t15-/m0/s1 |
| InChIKey | OTBJOORKNSCXQG-HNNXBMFYSA-N |
| XLogP | 3.14 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |