C17H14F2N4O2 — CID 4907359
N-(2,4-difluorophenyl)-2-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide (PubChem CID 4907359) has the molecular formula C17H14F2N4O2 and a molecular weight of 344.32 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide |
|---|---|
| PubChem CID | 4907359 |
| Molecular Formula | C17H14F2N4O2 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide |
| SMILES | CCC(C(=O)Nc1ccc(F)cc1F)n1nnc2ccccc2c1=O |
| InChI | InChI=1S/C17H14F2N4O2/c1-2-15(16(24)20-14-8-7-10(18)9-12(14)19)23-17(25)11-5-3-4-6-13(11)21-22-23/h3-9,15H,2H2,1H3,(H,20,24) |
| InChIKey | OOGAHKIGRCCGQK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |