C11H11N3O2 — CID 170011258
3-(3-oxobutan-2-yl)-1,2,3-benzotriazin-4-one (PubChem CID 170011258) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 3-(3-oxobutan-2-yl)-1,2,3-benzotriazin-4-one.
| Compound Name | 3-(3-oxobutan-2-yl)-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 170011258 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-(3-oxobutan-2-yl)-1,2,3-benzotriazin-4-one |
| SMILES | CC(=O)C(C)n1nnc2ccccc2c1=O |
| InChI | InChI=1S/C11H11N3O2/c1-7(8(2)15)14-11(16)9-5-3-4-6-10(9)12-13-14/h3-7H,1-2H3 |
| InChIKey | HZSCAMZEKJTLRJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |