C18H19N5O2 — CID 7553409
(2S)-N-[4-(dimethylamino)phenyl]-2-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide (PubChem CID 7553409) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is (2S)-N-[4-(dimethylamino)phenyl]-2-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide.
| Compound Name | (2S)-N-[4-(dimethylamino)phenyl]-2-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide |
|---|---|
| PubChem CID | 7553409 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (2S)-N-[4-(dimethylamino)phenyl]-2-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(N(C)C)cc1)n1nnc2ccccc2c1=O |
| InChI | InChI=1S/C18H19N5O2/c1-12(17(24)19-13-8-10-14(11-9-13)22(2)3)23-18(25)15-6-4-5-7-16(15)20-21-23/h4-12H,1-3H3,(H,19,24)/t12-/m0/s1 |
| InChIKey | UTKBDGVUJVBYSL-LBPRGKRZSA-N |
| XLogP | 2.06 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|