C18H15Cl2N3O2 — CID 7596180
(2R)-N-(3,4-dichlorophenyl)-2-(4-oxoquinazolin-3-yl)butanamide (PubChem CID 7596180) has the molecular formula C18H15Cl2N3O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is (2R)-N-(3,4-dichlorophenyl)-2-(4-oxoquinazolin-3-yl)butanamide.
| Compound Name | (2R)-N-(3,4-dichlorophenyl)-2-(4-oxoquinazolin-3-yl)butanamide |
|---|---|
| PubChem CID | 7596180 |
| Molecular Formula | C18H15Cl2N3O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | (2R)-N-(3,4-dichlorophenyl)-2-(4-oxoquinazolin-3-yl)butanamide |
| SMILES | CC[C@H](C(=O)Nc1ccc(Cl)c(Cl)c1)n1cnc2ccccc2c1=O |
| InChI | InChI=1S/C18H15Cl2N3O2/c1-2-16(17(24)22-11-7-8-13(19)14(20)9-11)23-10-21-15-6-4-3-5-12(15)18(23)25/h3-10,16H,2H2,1H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | AOMBUYRWYIGVGP-MRXNPFEDSA-N |
| XLogP | 4.29 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |