C22H23N3O6 — CID 4870852
methyl 4,5-dimethoxy-2-[2-(4-oxoquinazolin-3-yl)butanoylamino]benzoate (PubChem CID 4870852) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-2-[2-(4-oxoquinazolin-3-yl)butanoylamino]benzoate.
| Compound Name | methyl 4,5-dimethoxy-2-[2-(4-oxoquinazolin-3-yl)butanoylamino]benzoate |
|---|---|
| PubChem CID | 4870852 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | methyl 4,5-dimethoxy-2-[2-(4-oxoquinazolin-3-yl)butanoylamino]benzoate |
| SMILES | CCC(C(=O)Nc1cc(OC)c(OC)cc1C(=O)OC)n1cnc2ccccc2c1=O |
| InChI | InChI=1S/C22H23N3O6/c1-5-17(25-12-23-15-9-7-6-8-13(15)21(25)27)20(26)24-16-11-19(30-3)18(29-2)10-14(16)22(28)31-4/h6-12,17H,5H2,1-4H3,(H,24,26) |
| InChIKey | WVSOBYZAVVIGBC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |