C47H39NO3 — CID 15725604
(2S)-2-(tritylamino)-3-(4-trityloxyphenyl)propanoic acid (PubChem CID 15725604) has the molecular formula C47H39NO3 and a molecular weight of 665.83 g/mol. Its IUPAC name is (2S)-2-(tritylamino)-3-(4-trityloxyphenyl)propanoic acid.
| Compound Name | (2S)-2-(tritylamino)-3-(4-trityloxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 15725604 |
| Molecular Formula | C47H39NO3 |
| Molecular Weight | 665.83 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | (2S)-2-(tritylamino)-3-(4-trityloxyphenyl)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(OC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C47H39NO3/c49-45(50)44(48-46(37-19-7-1-8-20-37,38-21-9-2-10-22-38)39-23-11-3-12-24-39)35-36-31-33-43(34-32-36)51-47(40-25-13-4-14-26-40,41-27-15-5-16-28-41)42-29-17-6-18-30-42/h1-34,44,48H,35H2,(H,49,50)/t44-/m0/s1 |
| InChIKey | KZQKVIQOLUDXDG-SJARJILFSA-N |
| XLogP | 9.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.83 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|