C11H12F3NO5S — CID 146137220
2-(methanesulfonamido)-3-[4-(trifluoromethoxy)phenyl]propanoic acid (PubChem CID 146137220) has the molecular formula C11H12F3NO5S and a molecular weight of 327.28 g/mol. Its IUPAC name is 2-(methanesulfonamido)-3-[4-(trifluoromethoxy)phenyl]propanoic acid.
| Compound Name | 2-(methanesulfonamido)-3-[4-(trifluoromethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 146137220 |
| Molecular Formula | C11H12F3NO5S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2-(methanesulfonamido)-3-[4-(trifluoromethoxy)phenyl]propanoic acid |
| SMILES | CS(=O)(=O)NC(Cc1ccc(OC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C11H12F3NO5S/c1-21(18,19)15-9(10(16)17)6-7-2-4-8(5-3-7)20-11(12,13)14/h2-5,9,15H,6H2,1H3,(H,16,17) |
| InChIKey | NNAUBCXSELECPF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |