C28H26NO5P — CID 70081809
(2S)-2-[[diphenyl(phosphono)methyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 70081809) has the molecular formula C28H26NO5P and a molecular weight of 487.49 g/mol. Its IUPAC name is (2S)-2-[[diphenyl(phosphono)methyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | (2S)-2-[[diphenyl(phosphono)methyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 70081809 |
| Molecular Formula | C28H26NO5P |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | (2S)-2-[[diphenyl(phosphono)methyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(c1ccccc1)(c1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C28H26NO5P/c30-27(31)26(20-21-16-18-23(19-17-21)22-10-4-1-5-11-22)29-28(35(32,33)34,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-19,26,29H,20H2,(H,30,31)(H2,32,33,34)/t26-/m0/s1 |
| InChIKey | MPSSWWVXFDMGKV-SANMLTNESA-N |
| XLogP | 5.02 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|