C33H35N3O6 — CID 66615741
2-amino-3-(4-phenylphenyl)propanoic acid;(2S)-2-[2-[(1S)-1-carboxy-2-phenylethyl]hydrazinyl]-3-phenylpropanoic acid (PubChem CID 66615741) has the molecular formula C33H35N3O6 and a molecular weight of 569.66 g/mol. Its IUPAC name is 2-amino-3-(4-phenylphenyl)propanoic acid;(2S)-2-[2-[(1S)-1-carboxy-2-phenylethyl]hydrazinyl]-3-phenylpropanoic acid.
| Compound Name | 2-amino-3-(4-phenylphenyl)propanoic acid;(2S)-2-[2-[(1S)-1-carboxy-2-phenylethyl]hydrazinyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 66615741 |
| Molecular Formula | C33H35N3O6 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 2-amino-3-(4-phenylphenyl)propanoic acid;(2S)-2-[2-[(1S)-1-carboxy-2-phenylethyl]hydrazinyl]-3-phenylpropanoic acid |
| SMILES | NC(Cc1ccc(-c2ccccc2)cc1)C(=O)O.O=C(O)[C@H](Cc1ccccc1)NN[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H20N2O4.C15H15NO2/c21-17(22)15(11-13-7-3-1-4-8-13)19-20-16(18(23)24)12-14-9-5-2-6-10-14;16-14(15(17)18)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-10,15-16,19-20H,11-12H2,(H,21,22)(H,23,24);1-9,14H,10,16H2,(H,17,18)/t15-,16-;/m0./s1 |
| InChIKey | JGLWNNYGDMCHGJ-MOGJOVFKSA-N |
| XLogP | 3.78 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|