C25H26N2O — CID 139888249
N-[3-(tritylamino)propyl]prop-2-enamide (PubChem CID 139888249) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is N-[3-(tritylamino)propyl]prop-2-enamide.
| Compound Name | N-[3-(tritylamino)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 139888249 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[3-(tritylamino)propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O/c1-2-24(28)26-19-12-20-27-25(21-13-6-3-7-14-21,22-15-8-4-9-16-22)23-17-10-5-11-18-23/h2-11,13-18,27H,1,12,19-20H2,(H,26,28) |
| InChIKey | RXXCPICGPMDMKM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|