C12H15NO2 — CID 166414439
N-[(3R)-3-hydroxy-3-phenylpropyl]prop-2-enamide (PubChem CID 166414439) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-[(3R)-3-hydroxy-3-phenylpropyl]prop-2-enamide.
| Compound Name | N-[(3R)-3-hydroxy-3-phenylpropyl]prop-2-enamide |
|---|---|
| PubChem CID | 166414439 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-[(3R)-3-hydroxy-3-phenylpropyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c1-2-12(15)13-9-8-11(14)10-6-4-3-5-7-10/h2-7,11,14H,1,8-9H2,(H,13,15)/t11-/m1/s1 |
| InChIKey | MBDKTXYZAVYCDY-LLVKDONJSA-N |
| XLogP | 1.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|