C8H11F3N2O2 — CID 18970234
N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]prop-2-enamide (PubChem CID 18970234) has the molecular formula C8H11F3N2O2 and a molecular weight of 224.18 g/mol. Its IUPAC name is N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]prop-2-enamide.
| Compound Name | N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 18970234 |
| Molecular Formula | C8H11F3N2O2 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O2/c1-2-6(14)12-4-3-5-13-7(15)8(9,10)11/h2H,1,3-5H2,(H,12,14)(H,13,15) |
| InChIKey | IBROGWDGQDNFSW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|