C8H12F2N2O3S — CID 146374463
N-[2-[(2,2-difluoro-2-methylsulfinylacetyl)amino]ethyl]prop-2-enamide (PubChem CID 146374463) has the molecular formula C8H12F2N2O3S and a molecular weight of 254.26 g/mol. Its IUPAC name is N-[2-[(2,2-difluoro-2-methylsulfinylacetyl)amino]ethyl]prop-2-enamide.
| Compound Name | N-[2-[(2,2-difluoro-2-methylsulfinylacetyl)amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 146374463 |
| Molecular Formula | C8H12F2N2O3S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | N-[2-[(2,2-difluoro-2-methylsulfinylacetyl)amino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCNC(=O)C(F)(F)S(C)=O |
| InChI | InChI=1S/C8H12F2N2O3S/c1-3-6(13)11-4-5-12-7(14)8(9,10)16(2)15/h3H,1,4-5H2,2H3,(H,11,13)(H,12,14) |
| InChIKey | GAWXWKWLILUPDY-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|