C15H23N3O4 — CID 146370629
(2E,4E)-N'-(1-hydroxy-2-methylpropan-2-yl)-N-[2-(prop-2-enoylamino)ethyl]hexa-2,4-dienediamide (PubChem CID 146370629) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is (2E,4E)-N'-(1-hydroxy-2-methylpropan-2-yl)-N-[2-(prop-2-enoylamino)ethyl]hexa-2,4-dienediamide.
| Compound Name | (2E,4E)-N'-(1-hydroxy-2-methylpropan-2-yl)-N-[2-(prop-2-enoylamino)ethyl]hexa-2,4-dienediamide |
|---|---|
| PubChem CID | 146370629 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2E,4E)-N'-(1-hydroxy-2-methylpropan-2-yl)-N-[2-(prop-2-enoylamino)ethyl]hexa-2,4-dienediamide |
| SMILES | C=CC(=O)NCCNC(=O)/C=C/C=C/C(=O)NC(C)(C)CO |
| InChI | InChI=1S/C15H23N3O4/c1-4-12(20)16-9-10-17-13(21)7-5-6-8-14(22)18-15(2,3)11-19/h4-8,19H,1,9-11H2,2-3H3,(H,16,20)(H,17,21)(H,18,22)/b7-5+,8-6+ |
| InChIKey | HPNKSAXKNUMZNW-KQQUZDAGSA-N |
| XLogP | -0.60 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|