C28H32N2O3S — CID 121476383
ethyl 3-[2-[[2-(tritylamino)acetyl]amino]ethylsulfanyl]propanoate (PubChem CID 121476383) has the molecular formula C28H32N2O3S and a molecular weight of 476.64 g/mol. Its IUPAC name is ethyl 3-[2-[[2-(tritylamino)acetyl]amino]ethylsulfanyl]propanoate.
| Compound Name | ethyl 3-[2-[[2-(tritylamino)acetyl]amino]ethylsulfanyl]propanoate |
|---|---|
| PubChem CID | 121476383 |
| Molecular Formula | C28H32N2O3S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | ethyl 3-[2-[[2-(tritylamino)acetyl]amino]ethylsulfanyl]propanoate |
| SMILES | CCOC(=O)CCSCCNC(=O)CNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32N2O3S/c1-2-33-27(32)18-20-34-21-19-29-26(31)22-30-28(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,30H,2,18-22H2,1H3,(H,29,31) |
| InChIKey | KNPSXDKIVCQLOH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|