About (2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate
(2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate (PubChem CID 154411294) has the molecular formula C24H30O4S
and a molecular weight of 414.57 g/mol. Its IUPAC name is (2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | (2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate |
| PubChem CID | 154411294 |
| Molecular Formula | C24H30O4S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate |
| SMILES | CCc1ccccc1COC(=O)CCSCCC(=O)OCc1ccccc1CC |
| InChI | InChI=1S/C24H30O4S/c1-3-19-9-5-7-11-21(19)17-27-23(25)13-15-29-16-14-24(26)28-18-22-12-8-6-10-20(22)4-2/h5-12H,3-4,13-18H2,1-2H3 |
| InChIKey | WRMKJGMTDAPPCU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate?
The IUPAC name of (2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate (CID 154411294) is (2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate.
What is the SMILES notation for (2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate?
The canonical SMILES for (2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate is CCc1ccccc1COC(=O)CCSCCC(=O)OCc1ccccc1CC.
What is the InChIKey of (2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate?
The InChIKey is WRMKJGMTDAPPCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O4S/c1-3-19-9-5-7-11-21(19)17-27-23(25)13-15-29-16-14-24(26)28-18-22-12-8-6-10-20(22)4-2/h5-12H,3-4,13-18H2,1-2H3.
What are the key properties of (2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate?
(2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate has a molecular weight of 414.57 g/mol, XLogP of 5.11, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylphenyl)methyl 3-[3-[(2-ethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoate is sourced from PubChem (CID 154411294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).