About [2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate
[2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate (PubChem CID 122496099) has the molecular formula C19H24O5
and a molecular weight of 332.40 g/mol. Its IUPAC name is [2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate.
Molecular Properties
| Compound Name | [2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate |
| PubChem CID | 122496099 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | [2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate |
| SMILES | C=C(C)CCC(=O)OCc1ccccc1COC(=O)CCC(C)=O |
| InChI | InChI=1S/C19H24O5/c1-14(2)8-10-18(21)23-12-16-6-4-5-7-17(16)13-24-19(22)11-9-15(3)20/h4-7H,1,8-13H2,2-3H3 |
| InChIKey | HCNWOVSGSHASKN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate?
The IUPAC name of [2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate (CID 122496099) is [2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate.
What is the SMILES notation for [2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate?
The canonical SMILES for [2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate is C=C(C)CCC(=O)OCc1ccccc1COC(=O)CCC(C)=O.
What is the InChIKey of [2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate?
The InChIKey is HCNWOVSGSHASKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O5/c1-14(2)8-10-18(21)23-12-16-6-4-5-7-17(16)13-24-19(22)11-9-15(3)20/h4-7H,1,8-13H2,2-3H3.
What are the key properties of [2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate?
[2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate has a molecular weight of 332.40 g/mol, XLogP of 3.50, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-oxopentanoyloxymethyl)phenyl]methyl 4-methylpent-4-enoate is sourced from PubChem (CID 122496099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).