C10H14NO7P — CID 22764519
[hydroxy-[(2-methoxy-2-oxoethyl)amino]-phenoxymethyl]phosphonic acid (PubChem CID 22764519) has the molecular formula C10H14NO7P and a molecular weight of 291.20 g/mol. Its IUPAC name is [hydroxy-[(2-methoxy-2-oxoethyl)amino]-phenoxymethyl]phosphonic acid.
| Compound Name | [hydroxy-[(2-methoxy-2-oxoethyl)amino]-phenoxymethyl]phosphonic acid |
|---|---|
| PubChem CID | 22764519 |
| Molecular Formula | C10H14NO7P |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | [hydroxy-[(2-methoxy-2-oxoethyl)amino]-phenoxymethyl]phosphonic acid |
| SMILES | COC(=O)CNC(O)(Oc1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C10H14NO7P/c1-17-9(12)7-11-10(13,19(14,15)16)18-8-5-3-2-4-6-8/h2-6,11,13H,7H2,1H3,(H2,14,15,16) |
| InChIKey | URGSSPYGGCNTLT-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|