C11H13F3NO7P — CID 70628025
[hydroxy-[(2-methoxy-2-oxoethyl)amino]-[3-(trifluoromethyl)phenoxy]methyl]phosphonic acid (PubChem CID 70628025) has the molecular formula C11H13F3NO7P and a molecular weight of 359.19 g/mol. Its IUPAC name is [hydroxy-[(2-methoxy-2-oxoethyl)amino]-[3-(trifluoromethyl)phenoxy]methyl]phosphonic acid.
| Compound Name | [hydroxy-[(2-methoxy-2-oxoethyl)amino]-[3-(trifluoromethyl)phenoxy]methyl]phosphonic acid |
|---|---|
| PubChem CID | 70628025 |
| Molecular Formula | C11H13F3NO7P |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | [hydroxy-[(2-methoxy-2-oxoethyl)amino]-[3-(trifluoromethyl)phenoxy]methyl]phosphonic acid |
| SMILES | COC(=O)CNC(O)(Oc1cccc(C(F)(F)F)c1)P(=O)(O)O |
| InChI | InChI=1S/C11H13F3NO7P/c1-21-9(16)6-15-11(17,23(18,19)20)22-8-4-2-3-7(5-8)10(12,13)14/h2-5,15,17H,6H2,1H3,(H2,18,19,20) |
| InChIKey | NHSSJVDRSUIRPR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|