C13H15F3O4 — CID 117237022
methyl 4-hydroxy-2-[[3-(trifluoromethyl)phenoxy]methyl]butanoate (PubChem CID 117237022) has the molecular formula C13H15F3O4 and a molecular weight of 292.25 g/mol. Its IUPAC name is methyl 4-hydroxy-2-[[3-(trifluoromethyl)phenoxy]methyl]butanoate.
| Compound Name | methyl 4-hydroxy-2-[[3-(trifluoromethyl)phenoxy]methyl]butanoate |
|---|---|
| PubChem CID | 117237022 |
| Molecular Formula | C13H15F3O4 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | methyl 4-hydroxy-2-[[3-(trifluoromethyl)phenoxy]methyl]butanoate |
| SMILES | COC(=O)C(CCO)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3O4/c1-19-12(18)9(5-6-17)8-20-11-4-2-3-10(7-11)13(14,15)16/h2-4,7,9,17H,5-6,8H2,1H3 |
| InChIKey | BWAZZNDBRLPZGC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |