C17H20NO9P — CID 22764506
2-[[bis(4-methoxyphenoxy)-phosphonomethyl]amino]acetic acid (PubChem CID 22764506) has the molecular formula C17H20NO9P and a molecular weight of 413.32 g/mol. Its IUPAC name is 2-[[bis(4-methoxyphenoxy)-phosphonomethyl]amino]acetic acid.
| Compound Name | 2-[[bis(4-methoxyphenoxy)-phosphonomethyl]amino]acetic acid |
|---|---|
| PubChem CID | 22764506 |
| Molecular Formula | C17H20NO9P |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-[[bis(4-methoxyphenoxy)-phosphonomethyl]amino]acetic acid |
| SMILES | COc1ccc(OC(NCC(=O)O)(Oc2ccc(OC)cc2)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C17H20NO9P/c1-24-12-3-7-14(8-4-12)26-17(28(21,22)23,18-11-16(19)20)27-15-9-5-13(25-2)6-10-15/h3-10,18H,11H2,1-2H3,(H,19,20)(H2,21,22,23) |
| InChIKey | MSXBNHPTLXJIGN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|