C17H19N2O4P — CID 164662650
methyl 2-[[2-(diphenylphosphorylamino)-2-oxoethyl]amino]acetate (PubChem CID 164662650) has the molecular formula C17H19N2O4P and a molecular weight of 346.32 g/mol. Its IUPAC name is methyl 2-[[2-(diphenylphosphorylamino)-2-oxoethyl]amino]acetate.
| Compound Name | methyl 2-[[2-(diphenylphosphorylamino)-2-oxoethyl]amino]acetate |
|---|---|
| PubChem CID | 164662650 |
| Molecular Formula | C17H19N2O4P |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | methyl 2-[[2-(diphenylphosphorylamino)-2-oxoethyl]amino]acetate |
| SMILES | COC(=O)CNCC(=O)NP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19N2O4P/c1-23-17(21)13-18-12-16(20)19-24(22,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,18H,12-13H2,1H3,(H,19,20,22) |
| InChIKey | FKVJLHIUMVARIW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|