About diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate
diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate (PubChem CID 139081479) has the molecular formula C22H23N2O5P
and a molecular weight of 426.41 g/mol. Its IUPAC name is diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate.
Molecular Properties
| Compound Name | diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate |
| PubChem CID | 139081479 |
| Molecular Formula | C22H23N2O5P |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate |
| SMILES | COC(=O)NNC(=O)OC.O=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15OP.C4H8N2O4/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9-3(7)5-6-4(8)10-2/h1-15H;1-2H3,(H,5,7)(H,6,8) |
| InChIKey | SQBPXONRRMIXPA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate?
The IUPAC name of diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate (CID 139081479) is diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate.
What is the SMILES notation for diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate?
The canonical SMILES for diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate is COC(=O)NNC(=O)OC.O=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate?
The InChIKey is SQBPXONRRMIXPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15OP.C4H8N2O4/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9-3(7)5-6-4(8)10-2/h1-15H;1-2H3,(H,5,7)(H,6,8).
What are the key properties of diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate?
diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate has a molecular weight of 426.41 g/mol, XLogP of 2.94, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphorylbenzene;methyl N-(methoxycarbonylamino)carbamate is sourced from PubChem (CID 139081479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).