C10H11O4P — CID 15948085
2-[methoxy(phenyl)phosphoryl]prop-2-enoic acid (PubChem CID 15948085) has the molecular formula C10H11O4P and a molecular weight of 226.17 g/mol. Its IUPAC name is 2-[methoxy(phenyl)phosphoryl]prop-2-enoic acid.
| Compound Name | 2-[methoxy(phenyl)phosphoryl]prop-2-enoic acid |
|---|---|
| PubChem CID | 15948085 |
| Molecular Formula | C10H11O4P |
| Molecular Weight | 226.17 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 2-[methoxy(phenyl)phosphoryl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)[P@](=O)(OC)c1ccccc1 |
| InChI | InChI=1S/C10H11O4P/c1-8(10(11)12)15(13,14-2)9-6-4-3-5-7-9/h3-7H,1H2,2H3,(H,11,12)/t15-/m0/s1 |
| InChIKey | GTBYXPOWGGXEJG-HNNXBMFYSA-N |
| XLogP | 1.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|