C44H34N2O4P2 — CID 177476151
4-diphenylphosphoryl-N-[4-[(4-diphenylphosphorylbenzoyl)amino]phenyl]benzamide (PubChem CID 177476151) has the molecular formula C44H34N2O4P2 and a molecular weight of 716.71 g/mol. Its IUPAC name is 4-diphenylphosphoryl-N-[4-[(4-diphenylphosphorylbenzoyl)amino]phenyl]benzamide.
| Compound Name | 4-diphenylphosphoryl-N-[4-[(4-diphenylphosphorylbenzoyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 177476151 |
| Molecular Formula | C44H34N2O4P2 |
| Molecular Weight | 716.71 g/mol |
| Exact Mass | 716.20 |
| IUPAC Name | 4-diphenylphosphoryl-N-[4-[(4-diphenylphosphorylbenzoyl)amino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccc(P(=O)(c3ccccc3)c3ccccc3)cc2)cc1)c1ccc(P(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C44H34N2O4P2/c47-43(33-21-29-41(30-22-33)51(49,37-13-5-1-6-14-37)38-15-7-2-8-16-38)45-35-25-27-36(28-26-35)46-44(48)34-23-31-42(32-24-34)52(50,39-17-9-3-10-18-39)40-19-11-4-12-20-40/h1-32H,(H,45,47)(H,46,48) |
| InChIKey | YGVNFQKIZPEBEH-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.71 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|