C12H17ClF3NO4S2 — CID 91503900
2-methylbutan-2-ylbenzene;N-(trifluoromethylsulfonyl)sulfamoyl chloride (PubChem CID 91503900) has the molecular formula C12H17ClF3NO4S2 and a molecular weight of 395.85 g/mol. Its IUPAC name is 2-methylbutan-2-ylbenzene;N-(trifluoromethylsulfonyl)sulfamoyl chloride.
| Compound Name | 2-methylbutan-2-ylbenzene;N-(trifluoromethylsulfonyl)sulfamoyl chloride |
|---|---|
| PubChem CID | 91503900 |
| Molecular Formula | C12H17ClF3NO4S2 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | 2-methylbutan-2-ylbenzene;N-(trifluoromethylsulfonyl)sulfamoyl chloride |
| SMILES | CCC(C)(C)c1ccccc1.O=S(=O)(Cl)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H16.CHClF3NO4S2/c1-4-11(2,3)10-8-6-5-7-9-10;2-12(9,10)6-11(7,8)1(3,4)5/h5-9H,4H2,1-3H3;6H |
| InChIKey | IGMPDCGJHDSCRL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |