C22H32O — CID 175328016
1,3-bis(2-methylbutan-2-yl)benzene;phenol (PubChem CID 175328016) has the molecular formula C22H32O and a molecular weight of 312.50 g/mol. Its IUPAC name is 1,3-bis(2-methylbutan-2-yl)benzene;phenol.
| Compound Name | 1,3-bis(2-methylbutan-2-yl)benzene;phenol |
|---|---|
| PubChem CID | 175328016 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 1,3-bis(2-methylbutan-2-yl)benzene;phenol |
| SMILES | CCC(C)(C)c1cccc(C(C)(C)CC)c1.Oc1ccccc1 |
| InChI | InChI=1S/C16H26.C6H6O/c1-7-15(3,4)13-10-9-11-14(12-13)16(5,6)8-2;7-6-4-2-1-3-5-6/h9-12H,7-8H2,1-6H3;1-5,7H |
| InChIKey | YZGANMDCNLDASH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |