C20H28O2 — CID 66744963
phenol;4-(2,3,3-trimethylpentan-2-yl)phenol (PubChem CID 66744963) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is phenol;4-(2,3,3-trimethylpentan-2-yl)phenol.
| Compound Name | phenol;4-(2,3,3-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 66744963 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | phenol;4-(2,3,3-trimethylpentan-2-yl)phenol |
| SMILES | CCC(C)(C)C(C)(C)c1ccc(O)cc1.Oc1ccccc1 |
| InChI | InChI=1S/C14H22O.C6H6O/c1-6-13(2,3)14(4,5)11-7-9-12(15)10-8-11;7-6-4-2-1-3-5-6/h7-10,15H,6H2,1-5H3;1-5,7H |
| InChIKey | WIMDADCMDRBSKC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |