C23H40O — CID 144913920
4-(2,3,3,4,4,5,5,6,6-nonamethyloctan-2-yl)phenol (PubChem CID 144913920) has the molecular formula C23H40O and a molecular weight of 332.57 g/mol. Its IUPAC name is 4-(2,3,3,4,4,5,5,6,6-nonamethyloctan-2-yl)phenol.
| Compound Name | 4-(2,3,3,4,4,5,5,6,6-nonamethyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 144913920 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | 4-(2,3,3,4,4,5,5,6,6-nonamethyloctan-2-yl)phenol |
| SMILES | CCC(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H40O/c1-12-19(2,3)21(6,7)23(10,11)22(8,9)20(4,5)17-13-15-18(24)16-14-17/h13-16,24H,12H2,1-11H3 |
| InChIKey | UJUKRPIUAOJXRF-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |