C18H30O — CID 22924828
4-(5,5,6,6-tetramethyloctan-4-yl)phenol (PubChem CID 22924828) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 4-(5,5,6,6-tetramethyloctan-4-yl)phenol.
| Compound Name | 4-(5,5,6,6-tetramethyloctan-4-yl)phenol |
|---|---|
| PubChem CID | 22924828 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 4-(5,5,6,6-tetramethyloctan-4-yl)phenol |
| SMILES | CCCC(c1ccc(O)cc1)C(C)(C)C(C)(C)CC |
| InChI | InChI=1S/C18H30O/c1-7-9-16(14-10-12-15(19)13-11-14)18(5,6)17(3,4)8-2/h10-13,16,19H,7-9H2,1-6H3 |
| InChIKey | NZTFONKFAOHNMX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |