About (6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal
(6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal (PubChem CID 73352769) has the molecular formula C22H28O3
and a molecular weight of 340.46 g/mol. Its IUPAC name is (6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal.
Molecular Properties
| Compound Name | (6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal |
| PubChem CID | 73352769 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal |
| SMILES | CC[C@@](C)(c1ccc(O)cc1)[C@H](CCCCC=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H28O3/c1-3-22(2,18-10-14-20(25)15-11-18)21(7-5-4-6-16-23)17-8-12-19(24)13-9-17/h8-16,21,24-25H,3-7H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | ZVCICJNXCQZGCU-YADHBBJMSA-N |
| XLogP | 5.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal?
The IUPAC name of (6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal (CID 73352769) is (6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal.
What is the SMILES notation for (6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal?
The canonical SMILES for (6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal is CC[C@@](C)(c1ccc(O)cc1)[C@H](CCCCC=O)c1ccc(O)cc1.
What is the InChIKey of (6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal?
The InChIKey is ZVCICJNXCQZGCU-YADHBBJMSA-N. The full InChI is InChI=1S/C22H28O3/c1-3-22(2,18-10-14-20(25)15-11-18)21(7-5-4-6-16-23)17-8-12-19(24)13-9-17/h8-16,21,24-25H,3-7H2,1-2H3/t21-,22+/m1/s1.
What are the key properties of (6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal?
(6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal has a molecular weight of 340.46 g/mol, XLogP of 5.31, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R,7R)-6,7-bis(4-hydroxyphenyl)-7-methylnonanal is sourced from PubChem (CID 73352769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).