C17H20N2O — CID 141107541
4-(2-methylbutan-2-yl)-2-phenyldiazenylphenol (PubChem CID 141107541) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-(2-methylbutan-2-yl)-2-phenyldiazenylphenol.
| Compound Name | 4-(2-methylbutan-2-yl)-2-phenyldiazenylphenol |
|---|---|
| PubChem CID | 141107541 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 4-(2-methylbutan-2-yl)-2-phenyldiazenylphenol |
| SMILES | CCC(C)(C)c1ccc(O)c(/N=N/c2ccccc2)c1 |
| InChI | InChI=1S/C17H20N2O/c1-4-17(2,3)13-10-11-16(20)15(12-13)19-18-14-8-6-5-7-9-14/h5-12,20H,4H2,1-3H3/b19-18+ |
| InChIKey | UEOUVTNRDITGTR-VHEBQXMUSA-N |
| XLogP | 5.50 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|