C19H24O — CID 174821051
4-[2,6-dimethyl-4-(2-methylbutan-2-yl)phenyl]phenol (PubChem CID 174821051) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-[2,6-dimethyl-4-(2-methylbutan-2-yl)phenyl]phenol.
| Compound Name | 4-[2,6-dimethyl-4-(2-methylbutan-2-yl)phenyl]phenol |
|---|---|
| PubChem CID | 174821051 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 4-[2,6-dimethyl-4-(2-methylbutan-2-yl)phenyl]phenol |
| SMILES | CCC(C)(C)c1cc(C)c(-c2ccc(O)cc2)c(C)c1 |
| InChI | InChI=1S/C19H24O/c1-6-19(4,5)16-11-13(2)18(14(3)12-16)15-7-9-17(20)10-8-15/h7-12,20H,6H2,1-5H3 |
| InChIKey | DBKZKXAPLFEYLF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |