C15H16O2 — CID 101299207
3-(4-hydroxyphenyl)-2,4,5-trimethylphenol (PubChem CID 101299207) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2,4,5-trimethylphenol.
| Compound Name | 3-(4-hydroxyphenyl)-2,4,5-trimethylphenol |
|---|---|
| PubChem CID | 101299207 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2,4,5-trimethylphenol |
| SMILES | Cc1cc(O)c(C)c(-c2ccc(O)cc2)c1C |
| InChI | InChI=1S/C15H16O2/c1-9-8-14(17)11(3)15(10(9)2)12-4-6-13(16)7-5-12/h4-8,16-17H,1-3H3 |
| InChIKey | FFOYHSYUUBSZNI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |