C26H22O2 — CID 88788542
4-(4-hydroxy-3-methylphenyl)-2-methyl-3,5-diphenylphenol (PubChem CID 88788542) has the molecular formula C26H22O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-(4-hydroxy-3-methylphenyl)-2-methyl-3,5-diphenylphenol.
| Compound Name | 4-(4-hydroxy-3-methylphenyl)-2-methyl-3,5-diphenylphenol |
|---|---|
| PubChem CID | 88788542 |
| Molecular Formula | C26H22O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-(4-hydroxy-3-methylphenyl)-2-methyl-3,5-diphenylphenol |
| SMILES | Cc1cc(-c2c(-c3ccccc3)cc(O)c(C)c2-c2ccccc2)ccc1O |
| InChI | InChI=1S/C26H22O2/c1-17-15-21(13-14-23(17)27)26-22(19-9-5-3-6-10-19)16-24(28)18(2)25(26)20-11-7-4-8-12-20/h3-16,27-28H,1-2H3 |
| InChIKey | KWAACAWWLPQHOL-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |