About CID 175980363
CID 175980363 (PubChem CID 175980363) has the molecular formula C26H22KO
and a molecular weight of 389.56 g/mol.
Molecular Properties
| Compound Name | CID 175980363 |
| PubChem CID | 175980363 |
| Molecular Formula | C26H22KO |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | — |
| SMILES | CCc1c(O)cc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.[K] |
| InChI | InChI=1S/C26H22O.K/c1-2-22-24(27)18-23(19-12-6-3-7-13-19)26(21-16-10-5-11-17-21)25(22)20-14-8-4-9-15-20;/h3-18,27H,2H2,1H3; |
| InChIKey | IHYBCFVXMHLNHF-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 175980363 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175980363?
The IUPAC name of CID 175980363 (CID 175980363) is not available.
What is the SMILES notation for CID 175980363?
The canonical SMILES for CID 175980363 is CCc1c(O)cc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.[K].
What is the InChIKey of CID 175980363?
The InChIKey is IHYBCFVXMHLNHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22O.K/c1-2-22-24(27)18-23(19-12-6-3-7-13-19)26(21-16-10-5-11-17-21)25(22)20-14-8-4-9-15-20;/h3-18,27H,2H2,1H3;.
What are the key properties of CID 175980363?
CID 175980363 has a molecular weight of 389.56 g/mol, XLogP of 6.57, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175980363 is sourced from PubChem (CID 175980363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).