C17H20O3 — CID 23147068
4-ethyl-5-(2-methoxyethyl)-6-phenylbenzene-1,3-diol (PubChem CID 23147068) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 4-ethyl-5-(2-methoxyethyl)-6-phenylbenzene-1,3-diol.
| Compound Name | 4-ethyl-5-(2-methoxyethyl)-6-phenylbenzene-1,3-diol |
|---|---|
| PubChem CID | 23147068 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4-ethyl-5-(2-methoxyethyl)-6-phenylbenzene-1,3-diol |
| SMILES | CCc1c(O)cc(O)c(-c2ccccc2)c1CCOC |
| InChI | InChI=1S/C17H20O3/c1-3-13-14(9-10-20-2)17(16(19)11-15(13)18)12-7-5-4-6-8-12/h4-8,11,18-19H,3,9-10H2,1-2H3 |
| InChIKey | JHOACMLBWBAWOY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |